| Name | Furfuryl isopropyl sulfide |
| Synonyms | FEMA 3161 Furfuryl isopropyl s Furfuryl isopropyl sulfide FURFURYL ISOPROPYL SULFIDE FURFURYL ISOPROPYL SULPHIDE ISOPROPYL FURFURYL SULPHIDE Furfuryl isopropyl sulphide 2-[(isopropylthio)methyl]furan 2-(Propan-2-ylsulfanylmethyl)furan 2-[[(1-Methylethyl)thio]methyl]furan 2-[(propan-2-ylsulfanyl)methyl]furan |
| CAS | 1883-78-9 |
| EINECS | 606-138-3 |
| InChI | InChI=1/C8H12OS/c1-7(2)10-6-8-4-3-5-9-8/h3-5,7H,6H2,1-2H3 |
| Molecular Formula | C8H12OS |
| Molar Mass | 156.25 |
| Density | 0.998g/mLat 25°C(lit.) |
| Boling Point | 79-80°C12mm Hg(lit.) |
| Flash Point | 168°F |
| JECFA Number | 1077 |
| Vapor Presure | 0.47mmHg at 25°C |
| BRN | 1306593 |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | n20/D 1.504(lit.) |
| MDL | MFCD00040265 |
| Use | Used as food flavor |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R10 - Flammable |
| Safety Description | S23 - Do not breathe vapour. S24/25 - Avoid contact with skin and eyes. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| UN IDs | UN 3334 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29321900 |
| FEMA | 3161 | FURFURYL ISOPROPYL SULFIDE |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| Use | Used as food essence |